C11H16N2O3S — CID 38415489
ethyl N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]carbamate (PubChem CID 38415489) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is ethyl N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]carbamate.
| Compound Name | ethyl N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 38415489 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]carbamate |
| SMILES | CCOC(=O)NCCC(=O)NCc1cccs1 |
| InChI | InChI=1S/C11H16N2O3S/c1-2-16-11(15)12-6-5-10(14)13-8-9-4-3-7-17-9/h3-4,7H,2,5-6,8H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | NSXLZCSQIJZJBG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |