C9H15ClN2OS — CID 43810411
2-(ethylamino)-N-(thiophen-2-ylmethyl)acetamide;hydrochloride (PubChem CID 43810411) has the molecular formula C9H15ClN2OS and a molecular weight of 234.75 g/mol. Its IUPAC name is 2-(ethylamino)-N-(thiophen-2-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-(ethylamino)-N-(thiophen-2-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 43810411 |
| Molecular Formula | C9H15ClN2OS |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(ethylamino)-N-(thiophen-2-ylmethyl)acetamide;hydrochloride |
| SMILES | CCNCC(=O)NCc1cccs1.Cl |
| InChI | InChI=1S/C9H14N2OS.ClH/c1-2-10-7-9(12)11-6-8-4-3-5-13-8;/h3-5,10H,2,6-7H2,1H3,(H,11,12);1H |
| InChIKey | FXSIAUOSPCYUSE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |