C11H16N2OS3 — CID 146896544
2-propan-2-yloxy-N-(thiophen-2-ylmethylcarbamothioyl)ethanethioamide (PubChem CID 146896544) has the molecular formula C11H16N2OS3 and a molecular weight of 288.46 g/mol. Its IUPAC name is 2-propan-2-yloxy-N-(thiophen-2-ylmethylcarbamothioyl)ethanethioamide.
| Compound Name | 2-propan-2-yloxy-N-(thiophen-2-ylmethylcarbamothioyl)ethanethioamide |
|---|---|
| PubChem CID | 146896544 |
| Molecular Formula | C11H16N2OS3 |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-propan-2-yloxy-N-(thiophen-2-ylmethylcarbamothioyl)ethanethioamide |
| SMILES | CC(C)OCC(=S)NC(=S)NCc1cccs1 |
| InChI | InChI=1S/C11H16N2OS3/c1-8(2)14-7-10(15)13-11(16)12-6-9-4-3-5-17-9/h3-5,8H,6-7H2,1-2H3,(H2,12,13,15,16) |
| InChIKey | UCKXJQIPWBRGNA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|