C20H20N2S2 — CID 9111467
1-[(1R)-1-(4-phenylphenyl)ethyl]-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 9111467) has the molecular formula C20H20N2S2 and a molecular weight of 352.53 g/mol. Its IUPAC name is 1-[(1R)-1-(4-phenylphenyl)ethyl]-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[(1R)-1-(4-phenylphenyl)ethyl]-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9111467 |
| Molecular Formula | C20H20N2S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[(1R)-1-(4-phenylphenyl)ethyl]-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | C[C@@H](NC(=S)NCc1cccs1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N2S2/c1-15(22-20(23)21-14-19-8-5-13-24-19)16-9-11-18(12-10-16)17-6-3-2-4-7-17/h2-13,15H,14H2,1H3,(H2,21,22,23)/t15-/m1/s1 |
| InChIKey | BSTWVOMIBYMHGR-OAHLLOKOSA-N |
| XLogP | 5.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|