C28H25N3S2 — CID 3576078
1-[2-phenyl-2-(2-phenyl-1H-indol-3-yl)ethyl]-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 3576078) has the molecular formula C28H25N3S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 1-[2-phenyl-2-(2-phenyl-1H-indol-3-yl)ethyl]-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[2-phenyl-2-(2-phenyl-1H-indol-3-yl)ethyl]-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3576078 |
| Molecular Formula | C28H25N3S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[2-phenyl-2-(2-phenyl-1H-indol-3-yl)ethyl]-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | S=C(NCc1cccs1)NCC(c1ccccc1)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C28H25N3S2/c32-28(29-18-22-14-9-17-33-22)30-19-24(20-10-3-1-4-11-20)26-23-15-7-8-16-25(23)31-27(26)21-12-5-2-6-13-21/h1-17,24,31H,18-19H2,(H2,29,30,32) |
| InChIKey | NVDLFKDVOQZCNE-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|