C12H9NO2S — CID 3239870
2-thiophen-2-yl-2,3-dihydro-1,3-benzoxazin-4-one (PubChem CID 3239870) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-thiophen-2-yl-2,3-dihydro-1,3-benzoxazin-4-one.
| Compound Name | 2-thiophen-2-yl-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 3239870 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-thiophen-2-yl-2,3-dihydro-1,3-benzoxazin-4-one |
| SMILES | O=C1NC(c2cccs2)Oc2ccccc21 |
| InChI | InChI=1S/C12H9NO2S/c14-11-8-4-1-2-5-9(8)15-12(13-11)10-6-3-7-16-10/h1-7,12H,(H,13,14) |
| InChIKey | AGFNJEKZJADNQP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |