C20H15NO3 — CID 2320255
(2R)-2-(3-phenoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one (PubChem CID 2320255) has the molecular formula C20H15NO3 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2R)-2-(3-phenoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one.
| Compound Name | (2R)-2-(3-phenoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 2320255 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (2R)-2-(3-phenoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one |
| SMILES | O=C1N[C@@H](c2cccc(Oc3ccccc3)c2)Oc2ccccc21 |
| InChI | InChI=1S/C20H15NO3/c22-19-17-11-4-5-12-18(17)24-20(21-19)14-7-6-10-16(13-14)23-15-8-2-1-3-9-15/h1-13,20H,(H,21,22)/t20-/m1/s1 |
| InChIKey | UIDSZOPMTCYTPP-HXUWFJFHSA-N |
| XLogP | 4.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |