C19H19NO4 — CID 7450988
(2R)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one (PubChem CID 7450988) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (2R)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one.
| Compound Name | (2R)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 7450988 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2R)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-2,3-dihydro-1,3-benzoxazin-4-one |
| SMILES | C=CCOc1ccc([C@@H]2NC(=O)c3ccccc3O2)cc1OCC |
| InChI | InChI=1S/C19H19NO4/c1-3-11-23-16-10-9-13(12-17(16)22-4-2)19-20-18(21)14-7-5-6-8-15(14)24-19/h3,5-10,12,19H,1,4,11H2,2H3,(H,20,21)/t19-/m1/s1 |
| InChIKey | YVNDSURNXJRCIU-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|