C20H21NO4 — CID 7449385
(2R)-2-[3-ethoxy-4-(2-methylprop-2-enoxy)phenyl]-2,3-dihydro-1,3-benzoxazin-4-one (PubChem CID 7449385) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2R)-2-[3-ethoxy-4-(2-methylprop-2-enoxy)phenyl]-2,3-dihydro-1,3-benzoxazin-4-one.
| Compound Name | (2R)-2-[3-ethoxy-4-(2-methylprop-2-enoxy)phenyl]-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 7449385 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (2R)-2-[3-ethoxy-4-(2-methylprop-2-enoxy)phenyl]-2,3-dihydro-1,3-benzoxazin-4-one |
| SMILES | C=C(C)COc1ccc([C@@H]2NC(=O)c3ccccc3O2)cc1OCC |
| InChI | InChI=1S/C20H21NO4/c1-4-23-18-11-14(9-10-17(18)24-12-13(2)3)20-21-19(22)15-7-5-6-8-16(15)25-20/h5-11,20H,2,4,12H2,1,3H3,(H,21,22)/t20-/m1/s1 |
| InChIKey | DSKUKCIIKHXYSY-HXUWFJFHSA-N |
| XLogP | 3.86 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|