C21H20N4O5S — CID 22331286
2-[2-ethoxy-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenoxy]acetic acid (PubChem CID 22331286) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 22331286 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[2-ethoxy-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenoxy]acetic acid |
| SMILES | CCOc1cc(C2Nc3ccccc3-c3nnc(SC)nc3O2)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H20N4O5S/c1-3-28-16-10-12(8-9-15(16)29-11-17(26)27)19-22-14-7-5-4-6-13(14)18-20(30-19)23-21(31-2)25-24-18/h4-10,19,22H,3,11H2,1-2H3,(H,26,27) |
| InChIKey | RWEUXLOFZVERJU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |