C27H24N4O5 — CID 155602059
2-[2-methoxy-4-[(6S)-3-(2-phenylethyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid (PubChem CID 155602059) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(6S)-3-(2-phenylethyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[(6S)-3-(2-phenylethyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155602059 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[2-methoxy-4-[(6S)-3-(2-phenylethyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid |
| SMILES | COc1cc([C@H]2Nc3ccccc3-c3nnc(CCc4ccccc4)nc3O2)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H24N4O5/c1-34-22-15-18(12-13-21(22)35-16-24(32)33)26-28-20-10-6-5-9-19(20)25-27(36-26)29-23(30-31-25)14-11-17-7-3-2-4-8-17/h2-10,12-13,15,26,28H,11,14,16H2,1H3,(H,32,33)/t26-/m0/s1 |
| InChIKey | VMAURBVKWWBJJD-SANMLTNESA-N |
| XLogP | 4.30 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |