C27H25FN4O3S — CID 6415507
6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6415507) has the molecular formula C27H25FN4O3S and a molecular weight of 504.59 g/mol. Its IUPAC name is 6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6415507 |
| Molecular Formula | C27H25FN4O3S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCOc1ccc(C2Nc3ccccc3-c3nnc(SCc4ccccc4F)nc3O2)cc1OCC |
| InChI | InChI=1S/C27H25FN4O3S/c1-3-33-22-14-13-17(15-23(22)34-4-2)25-29-21-12-8-6-10-19(21)24-26(35-25)30-27(32-31-24)36-16-18-9-5-7-11-20(18)28/h5-15,25,29H,3-4,16H2,1-2H3 |
| InChIKey | NBPOBFIWLAITJJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |