C13H10O3S — CID 12023515
(4R,5S)-4-(furan-2-yl)-3-methylidene-5-thiophen-2-yloxolan-2-one (PubChem CID 12023515) has the molecular formula C13H10O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is (4R,5S)-4-(furan-2-yl)-3-methylidene-5-thiophen-2-yloxolan-2-one.
| Compound Name | (4R,5S)-4-(furan-2-yl)-3-methylidene-5-thiophen-2-yloxolan-2-one |
|---|---|
| PubChem CID | 12023515 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (4R,5S)-4-(furan-2-yl)-3-methylidene-5-thiophen-2-yloxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](c2cccs2)[C@@H]1c1ccco1 |
| InChI | InChI=1S/C13H10O3S/c1-8-11(9-4-2-6-15-9)12(16-13(8)14)10-5-3-7-17-10/h2-7,11-12H,1H2/t11-,12+/m0/s1 |
| InChIKey | YFVLEFPZQHSBGP-NWDGAFQWSA-N |
| XLogP | 3.28 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|