C11H9ClO4 — CID 97034925
(2R,3R)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxylic acid (PubChem CID 97034925) has the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. Its IUPAC name is (2R,3R)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxylic acid.
| Compound Name | (2R,3R)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 97034925 |
| Molecular Formula | C11H9ClO4 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (2R,3R)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxylic acid |
| SMILES | O=C1C[C@@H](C(=O)O)[C@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C11H9ClO4/c12-7-3-1-6(2-4-7)10-8(11(14)15)5-9(13)16-10/h1-4,8,10H,5H2,(H,14,15)/t8-,10+/m1/s1 |
| InChIKey | WJCJCSBZEIWYTB-SCZZXKLOSA-N |
| XLogP | 2.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |