C23H25ClN2O3 — CID 70841676
(2S,3S)-N-(1-benzylpiperidin-4-yl)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxamide (PubChem CID 70841676) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is (2S,3S)-N-(1-benzylpiperidin-4-yl)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxamide.
| Compound Name | (2S,3S)-N-(1-benzylpiperidin-4-yl)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxamide |
|---|---|
| PubChem CID | 70841676 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2S,3S)-N-(1-benzylpiperidin-4-yl)-2-(4-chlorophenyl)-5-oxooxolane-3-carboxamide |
| SMILES | O=C1C[C@H](C(=O)NC2CCN(Cc3ccccc3)CC2)[C@@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C23H25ClN2O3/c24-18-8-6-17(7-9-18)22-20(14-21(27)29-22)23(28)25-19-10-12-26(13-11-19)15-16-4-2-1-3-5-16/h1-9,19-20,22H,10-15H2,(H,25,28)/t20-,22+/m0/s1 |
| InChIKey | ZKVLLWLBBUDCQX-RBBKRZOGSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |