C27H26ClF3N2O7 — CID 73050891
(Z)-but-2-enedioic acid;(2R,3R)-2-(4-chlorophenyl)-5-oxo-N-[1-[(2,3,5-trifluorophenyl)methyl]piperidin-4-yl]oxolane-3-carboxamide (PubChem CID 73050891) has the molecular formula C27H26ClF3N2O7 and a molecular weight of 582.96 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(2R,3R)-2-(4-chlorophenyl)-5-oxo-N-[1-[(2,3,5-trifluorophenyl)methyl]piperidin-4-yl]oxolane-3-carboxamide.
| Compound Name | (Z)-but-2-enedioic acid;(2R,3R)-2-(4-chlorophenyl)-5-oxo-N-[1-[(2,3,5-trifluorophenyl)methyl]piperidin-4-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 73050891 |
| Molecular Formula | C27H26ClF3N2O7 |
| Molecular Weight | 582.96 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;(2R,3R)-2-(4-chlorophenyl)-5-oxo-N-[1-[(2,3,5-trifluorophenyl)methyl]piperidin-4-yl]oxolane-3-carboxamide |
| SMILES | O=C(O)/C=C\C(=O)O.O=C1C[C@@H](C(=O)NC2CCN(Cc3cc(F)cc(F)c3F)CC2)[C@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C23H22ClF3N2O3.C4H4O4/c24-15-3-1-13(2-4-15)22-18(11-20(30)32-22)23(31)28-17-5-7-29(8-6-17)12-14-9-16(25)10-19(26)21(14)27;5-3(6)1-2-4(7)8/h1-4,9-10,17-18,22H,5-8,11-12H2,(H,28,31);1-2H,(H,5,6)(H,7,8)/b;2-1-/t18-,22+;/m1./s1 |
| InChIKey | YHZNRAXDBMALSG-QRBUKCCXSA-N |
| XLogP | 3.85 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.96 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|