C16H20BrFN2O — CID 46444939
N-[1-[(4-bromo-2-fluorophenyl)methyl]piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 46444939) has the molecular formula C16H20BrFN2O and a molecular weight of 355.25 g/mol. Its IUPAC name is N-[1-[(4-bromo-2-fluorophenyl)methyl]piperidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[(4-bromo-2-fluorophenyl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46444939 |
| Molecular Formula | C16H20BrFN2O |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[1-[(4-bromo-2-fluorophenyl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Br)cc2F)CC1)C1CC1 |
| InChI | InChI=1S/C16H20BrFN2O/c17-13-4-3-12(15(18)9-13)10-20-7-5-14(6-8-20)19-16(21)11-1-2-11/h3-4,9,11,14H,1-2,5-8,10H2,(H,19,21) |
| InChIKey | ZBXLPWJVUYNQSQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |