C16H23BrF3IN4 — CID 111978183
1-[(4-bromo-2-fluorophenyl)methyl]-3-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methylguanidine;hydroiodide (PubChem CID 111978183) has the molecular formula C16H23BrF3IN4 and a molecular weight of 535.19 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-3-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111978183 |
| Molecular Formula | C16H23BrF3IN4 |
| Molecular Weight | 535.19 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Br)cc1F)NC1CCN(CC(F)F)CC1.I |
| InChI | InChI=1S/C16H22BrF3N4.HI/c1-21-16(22-9-11-2-3-12(17)8-14(11)18)23-13-4-6-24(7-5-13)10-15(19)20;/h2-3,8,13,15H,4-7,9-10H2,1H3,(H2,21,22,23);1H |
| InChIKey | KWZAKXJBFWMZHQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|