C12H15BrClN3 — CID 110934267
1-[(4-bromo-2-chlorophenyl)methyl]-3-cyclopropyl-2-methylguanidine (PubChem CID 110934267) has the molecular formula C12H15BrClN3 and a molecular weight of 316.63 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenyl)methyl]-3-cyclopropyl-2-methylguanidine.
| Compound Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-cyclopropyl-2-methylguanidine |
|---|---|
| PubChem CID | 110934267 |
| Molecular Formula | C12H15BrClN3 |
| Molecular Weight | 316.63 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-cyclopropyl-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Br)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C12H15BrClN3/c1-15-12(17-10-4-5-10)16-7-8-2-3-9(13)6-11(8)14/h2-3,6,10H,4-5,7H2,1H3,(H2,15,16,17) |
| InChIKey | KVAJGIXXMRFVMF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|