C12H17BrClN3 — CID 111125524
1-[(4-bromo-2-chlorophenyl)methyl]-2-methyl-3-propan-2-ylguanidine (PubChem CID 111125524) has the molecular formula C12H17BrClN3 and a molecular weight of 318.65 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenyl)methyl]-2-methyl-3-propan-2-ylguanidine.
| Compound Name | 1-[(4-bromo-2-chlorophenyl)methyl]-2-methyl-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111125524 |
| Molecular Formula | C12H17BrClN3 |
| Molecular Weight | 318.65 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenyl)methyl]-2-methyl-3-propan-2-ylguanidine |
| SMILES | C/N=C(/NCc1ccc(Br)cc1Cl)NC(C)C |
| InChI | InChI=1S/C12H17BrClN3/c1-8(2)17-12(15-3)16-7-9-4-5-10(13)6-11(9)14/h4-6,8H,7H2,1-3H3,(H2,15,16,17) |
| InChIKey | WDOKYLRNCVEJHI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.65 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|