C18H27BrFIN4 — CID 111978459
1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)guanidine;hydroiodide (PubChem CID 111978459) has the molecular formula C18H27BrFIN4 and a molecular weight of 525.25 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)guanidine;hydroiodide.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111978459 |
| Molecular Formula | C18H27BrFIN4 |
| Molecular Weight | 525.25 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Br)cc1F)NC1CC2CCCC(C1)N2C.I |
| InChI | InChI=1S/C18H26BrFN4.HI/c1-21-18(22-11-12-6-7-13(19)8-17(12)20)23-14-9-15-4-3-5-16(10-14)24(15)2;/h6-8,14-16H,3-5,9-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | LWGWWILGUUGNOV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|