C17H27BrFIN4 — CID 111017704
1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111017704) has the molecular formula C17H27BrFIN4 and a molecular weight of 513.24 g/mol. Its IUPAC name is 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111017704 |
| Molecular Formula | C17H27BrFIN4 |
| Molecular Weight | 513.24 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/C)NCc2ccc(Br)c(F)c2)CC1.I |
| InChI | InChI=1S/C17H26BrFN4.HI/c1-3-8-23-9-6-14(7-10-23)22-17(20-2)21-12-13-4-5-15(18)16(19)11-13;/h4-5,11,14H,3,6-10,12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | YENHVXUIPZLSEM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|