C20H31F3N4O — CID 111019701
2-methyl-1-(1-propylpiperidin-4-yl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111019701) has the molecular formula C20H31F3N4O and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-methyl-1-(1-propylpiperidin-4-yl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(1-propylpiperidin-4-yl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111019701 |
| Molecular Formula | C20H31F3N4O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-methyl-1-(1-propylpiperidin-4-yl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCCN1CCC(N/C(=N/C)NCc2ccc(COCC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H31F3N4O/c1-3-10-27-11-8-18(9-12-27)26-19(24-2)25-13-16-4-6-17(7-5-16)14-28-15-20(21,22)23/h4-7,18H,3,8-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | CQJPMEJONQHDLW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|