C11H9ClO5 — CID 102547393
2-(3-chloro-4-hydroxyphenyl)-5-oxooxolane-3-carboxylic acid (PubChem CID 102547393) has the molecular formula C11H9ClO5 and a molecular weight of 256.64 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxyphenyl)-5-oxooxolane-3-carboxylic acid.
| Compound Name | 2-(3-chloro-4-hydroxyphenyl)-5-oxooxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 102547393 |
| Molecular Formula | C11H9ClO5 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-(3-chloro-4-hydroxyphenyl)-5-oxooxolane-3-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)C(c2ccc(O)c(Cl)c2)O1 |
| InChI | InChI=1S/C11H9ClO5/c12-7-3-5(1-2-8(7)13)10-6(11(15)16)4-9(14)17-10/h1-3,6,10,13H,4H2,(H,15,16) |
| InChIKey | WHMWWFZRSMYFFA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |