C16H20O4 — CID 101074774
(1S,5S,6S,7R,8R)-6,8-dimethyl-7-phenylmethoxy-2,9-dioxabicyclo[3.3.1]nonan-3-one (PubChem CID 101074774) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (1S,5S,6S,7R,8R)-6,8-dimethyl-7-phenylmethoxy-2,9-dioxabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1S,5S,6S,7R,8R)-6,8-dimethyl-7-phenylmethoxy-2,9-dioxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 101074774 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (1S,5S,6S,7R,8R)-6,8-dimethyl-7-phenylmethoxy-2,9-dioxabicyclo[3.3.1]nonan-3-one |
| SMILES | C[C@@H]1[C@@H](OCc2ccccc2)[C@@H](C)[C@@H]2OC(=O)C[C@@H]1O2 |
| InChI | InChI=1S/C16H20O4/c1-10-13-8-14(17)20-16(19-13)11(2)15(10)18-9-12-6-4-3-5-7-12/h3-7,10-11,13,15-16H,8-9H2,1-2H3/t10-,11+,13-,15+,16-/m0/s1 |
| InChIKey | LHMOMZNZTWJZHD-UXWFCTFPSA-N |
| XLogP | 2.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |