C16H17ClO3 — CID 14919491
(3aR,5R,8R,8aS)-8-chloro-5-phenylmethoxy-3,3a,4,5,8,8a-hexahydrocyclohepta[b]furan-2-one (PubChem CID 14919491) has the molecular formula C16H17ClO3 and a molecular weight of 292.76 g/mol. Its IUPAC name is (3aR,5R,8R,8aS)-8-chloro-5-phenylmethoxy-3,3a,4,5,8,8a-hexahydrocyclohepta[b]furan-2-one.
| Compound Name | (3aR,5R,8R,8aS)-8-chloro-5-phenylmethoxy-3,3a,4,5,8,8a-hexahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 14919491 |
| Molecular Formula | C16H17ClO3 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (3aR,5R,8R,8aS)-8-chloro-5-phenylmethoxy-3,3a,4,5,8,8a-hexahydrocyclohepta[b]furan-2-one |
| SMILES | O=C1C[C@H]2C[C@@H](OCc3ccccc3)C=C[C@@H](Cl)[C@H]2O1 |
| InChI | InChI=1S/C16H17ClO3/c17-14-7-6-13(8-12-9-15(18)20-16(12)14)19-10-11-4-2-1-3-5-11/h1-7,12-14,16H,8-10H2/t12-,13+,14-,16+/m1/s1 |
| InChIKey | QVUOFDUINSCFRI-CTASWTNQSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|