C41H46O12 — CID 129274142
methyl (3S,4S,6S)-6-[[(3S,5R,6S)-4,6-dihydroxy-3,5-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-3,5-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 129274142) has the molecular formula C41H46O12 and a molecular weight of 730.81 g/mol. Its IUPAC name is methyl (3S,4S,6S)-6-[[(3S,5R,6S)-4,6-dihydroxy-3,5-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-3,5-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (3S,4S,6S)-6-[[(3S,5R,6S)-4,6-dihydroxy-3,5-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-3,5-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 129274142 |
| Molecular Formula | C41H46O12 |
| Molecular Weight | 730.81 g/mol |
| Exact Mass | 730.30 |
| IUPAC Name | methyl (3S,4S,6S)-6-[[(3S,5R,6S)-4,6-dihydroxy-3,5-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-3,5-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@H](OCC2O[C@H](O)[C@H](OCc3ccccc3)C(O)[C@@H]2OCc2ccccc2)C(OCc2ccccc2)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H46O12/c1-46-39(44)38-35(48-23-28-16-8-3-9-17-28)33(43)37(50-25-30-20-12-5-13-21-30)41(53-38)51-26-31-34(47-22-27-14-6-2-7-15-27)32(42)36(40(45)52-31)49-24-29-18-10-4-11-19-29/h2-21,31-38,40-43,45H,22-26H2,1H3/t31?,32?,33-,34+,35-,36+,37?,38?,40-,41-/m0/s1 |
| InChIKey | VBKAXBLSGZFVEP-VBRUTQJQSA-N |
| XLogP | 3.68 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |