C23H28O6S — CID 102071523
methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 102071523) has the molecular formula C23H28O6S and a molecular weight of 432.54 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 102071523 |
| Molecular Formula | C23H28O6S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | CCS[C@@H]1O[C@H](C(=O)OC)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O6S/c1-3-30-23-21(28-15-17-12-8-5-9-13-17)19(18(24)20(29-23)22(25)26-2)27-14-16-10-6-4-7-11-16/h4-13,18-21,23-24H,3,14-15H2,1-2H3/t18-,19-,20-,21+,23-/m0/s1 |
| InChIKey | PXDXUVTUJNPMFR-XANJAXJYSA-N |
| XLogP | 3.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |