C27H28O13 — CID 162776554
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-hydroxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate (PubChem CID 162776554) has the molecular formula C27H28O13 and a molecular weight of 560.51 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-hydroxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-hydroxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 162776554 |
| Molecular Formula | C27H28O13 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-hydroxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C(=O)OCc3ccccc3)cc2O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H28O13/c1-14(28)36-21-22(37-15(2)29)24(38-16(3)30)27(40-23(21)26(33)34-4)39-20-11-10-18(12-19(20)31)25(32)35-13-17-8-6-5-7-9-17/h5-12,21-24,27,31H,13H2,1-4H3/t21-,22-,23-,24+,27+/m0/s1 |
| InChIKey | BTQIXBNXKDWJAT-SJFDGGJZSA-N |
| XLogP | 1.82 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|