C30H33O7P — CID 102035206
(1R,2S,6S,8S,11R)-11-(diphenylphosphorylmethyl)-4,4-dimethyl-6-(phenylmethoxymethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 102035206) has the molecular formula C30H33O7P and a molecular weight of 536.56 g/mol. Its IUPAC name is (1R,2S,6S,8S,11R)-11-(diphenylphosphorylmethyl)-4,4-dimethyl-6-(phenylmethoxymethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1R,2S,6S,8S,11R)-11-(diphenylphosphorylmethyl)-4,4-dimethyl-6-(phenylmethoxymethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 102035206 |
| Molecular Formula | C30H33O7P |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (1R,2S,6S,8S,11R)-11-(diphenylphosphorylmethyl)-4,4-dimethyl-6-(phenylmethoxymethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H]3O[C@H](CP(=O)(c4ccccc4)c4ccccc4)OC[C@@H]3O[C@@]2(COCc2ccccc2)O1 |
| InChI | InChI=1S/C30H33O7P/c1-29(2)36-28-27-25(35-30(28,37-29)21-32-18-22-12-6-3-7-13-22)19-33-26(34-27)20-38(31,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,25-28H,18-21H2,1-2H3/t25-,26+,27+,28-,30-/m0/s1 |
| InChIKey | JKEKYWZRGKGRPI-YKWXTOPISA-N |
| XLogP | 4.21 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|