C26H39NO8 — CID 16657032
6-[[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methoxy]hexyl N-(4-methylphenyl)carbamate (PubChem CID 16657032) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is 6-[[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methoxy]hexyl N-(4-methylphenyl)carbamate.
| Compound Name | 6-[[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methoxy]hexyl N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 16657032 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 6-[[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methoxy]hexyl N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OCCCCCCOC[C@@]23O[C@H]4COC(C)(C)O[C@H]4[C@@H]2OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C26H39NO8/c1-18-10-12-19(13-11-18)27-23(28)30-15-9-7-6-8-14-29-17-26-22(34-25(4,5)35-26)21-20(32-26)16-31-24(2,3)33-21/h10-13,20-22H,6-9,14-17H2,1-5H3,(H,27,28)/t20-,21+,22-,26-/m0/s1 |
| InChIKey | JUXCFGJEOONGAC-MSZDEVHKSA-N |
| XLogP | 4.52 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|