C31H49ClN2O6 — CID 10076951
[(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-chlorophenyl)carbamate (PubChem CID 10076951) has the molecular formula C31H49ClN2O6 and a molecular weight of 581.19 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-chlorophenyl)carbamate.
| Compound Name | [(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 10076951 |
| Molecular Formula | C31H49ClN2O6 |
| Molecular Weight | 581.19 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | [(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-chlorophenyl)carbamate |
| SMILES | CCCCCCCCCCOC[C@@]12O[C@@H](CN3CCCCC3)[C@@H](OC(=O)Nc3ccc(Cl)cc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C31H49ClN2O6/c1-4-5-6-7-8-9-10-14-21-36-23-31-28(39-30(2,3)40-31)27(26(38-31)22-34-19-12-11-13-20-34)37-29(35)33-25-17-15-24(32)16-18-25/h15-18,26-28H,4-14,19-23H2,1-3H3,(H,33,35)/t26-,27+,28-,31-/m0/s1 |
| InChIKey | HAQPFIJCAWYXJU-NFAPWKBDSA-N |
| XLogP | 7.15 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.19 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|