C32H50N2O8 — CID 68591552
methyl 2-[4-[[(3aR,5R,6S,6aR)-5-(azepan-1-ylmethyl)-3a-(heptoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl]oxycarbonylamino]phenyl]acetate (PubChem CID 68591552) has the molecular formula C32H50N2O8 and a molecular weight of 590.76 g/mol. Its IUPAC name is methyl 2-[4-[[(3aR,5R,6S,6aR)-5-(azepan-1-ylmethyl)-3a-(heptoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl]oxycarbonylamino]phenyl]acetate.
| Compound Name | methyl 2-[4-[[(3aR,5R,6S,6aR)-5-(azepan-1-ylmethyl)-3a-(heptoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl]oxycarbonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 68591552 |
| Molecular Formula | C32H50N2O8 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | methyl 2-[4-[[(3aR,5R,6S,6aR)-5-(azepan-1-ylmethyl)-3a-(heptoxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl]oxycarbonylamino]phenyl]acetate |
| SMILES | CCCCCCCOC[C@]12O[C@H](CN3CCCCCC3)[C@H](OC(=O)Nc3ccc(CC(=O)OC)cc3)[C@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C32H50N2O8/c1-5-6-7-10-13-20-38-23-32-29(41-31(2,3)42-32)28(26(40-32)22-34-18-11-8-9-12-19-34)39-30(36)33-25-16-14-24(15-17-25)21-27(35)37-4/h14-17,26,28-29H,5-13,18-23H2,1-4H3,(H,33,36)/t26-,28+,29-,32-/m1/s1 |
| InChIKey | JDPBPAWGCQBUIZ-FTWHEKFWSA-N |
| XLogP | 5.43 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|