C28H44N2O8 — CID 10324905
[(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(morpholin-4-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-methoxyphenyl)carbamate (PubChem CID 10324905) has the molecular formula C28H44N2O8 and a molecular weight of 536.67 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(morpholin-4-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-methoxyphenyl)carbamate.
| Compound Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(morpholin-4-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10324905 |
| Molecular Formula | C28H44N2O8 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(morpholin-4-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-methoxyphenyl)carbamate |
| SMILES | CCCCCCCOC[C@@]12O[C@@H](CN3CCOCC3)[C@@H](OC(=O)Nc3ccc(OC)cc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C28H44N2O8/c1-5-6-7-8-9-16-34-20-28-25(37-27(2,3)38-28)24(23(36-28)19-30-14-17-33-18-15-30)35-26(31)29-21-10-12-22(32-4)13-11-21/h10-13,23-25H,5-9,14-20H2,1-4H3,(H,29,31)/t23-,24+,25-,28-/m0/s1 |
| InChIKey | VIMXIUSSSBFGTP-GIBNYFNHSA-N |
| XLogP | 4.18 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|