C29H47N3O7 — CID 69016837
[(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-[(2-morpholin-4-ylethylamino)methyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate (PubChem CID 69016837) has the molecular formula C29H47N3O7 and a molecular weight of 549.71 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-[(2-morpholin-4-ylethylamino)methyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate.
| Compound Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-[(2-morpholin-4-ylethylamino)methyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 69016837 |
| Molecular Formula | C29H47N3O7 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-[(2-morpholin-4-ylethylamino)methyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate |
| SMILES | CCCCCCCOC[C@@]12O[C@@H](CNCCN3CCOCC3)[C@@H](OC(=O)Nc3ccccc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C29H47N3O7/c1-4-5-6-7-11-18-35-22-29-26(38-28(2,3)39-29)25(36-27(33)31-23-12-9-8-10-13-23)24(37-29)21-30-14-15-32-16-19-34-20-17-32/h8-10,12-13,24-26,30H,4-7,11,14-22H2,1-3H3,(H,31,33)/t24-,25+,26-,29-/m0/s1 |
| InChIKey | JRTBQOPXCQMQLH-BVXNIFABSA-N |
| XLogP | 3.76 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|