C20H28N2O5S — CID 10070034
1-[(3'aS,4R,5'R,6'S,6'aS)-6'-hydroxy-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-5'-yl]-3-benzylthiourea (PubChem CID 10070034) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-[(3'aS,4R,5'R,6'S,6'aS)-6'-hydroxy-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-5'-yl]-3-benzylthiourea.
| Compound Name | 1-[(3'aS,4R,5'R,6'S,6'aS)-6'-hydroxy-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-5'-yl]-3-benzylthiourea |
|---|---|
| PubChem CID | 10070034 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[(3'aS,4R,5'R,6'S,6'aS)-6'-hydroxy-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-5'-yl]-3-benzylthiourea |
| SMILES | CC1(C)O[C@H]2[C@@H](O)[C@@H](NC(=S)NCc3ccccc3)[C@@]3(COC(C)(C)O3)[C@H]2O1 |
| InChI | InChI=1S/C20H28N2O5S/c1-18(2)24-11-20(27-18)15(13(23)14-16(20)26-19(3,4)25-14)22-17(28)21-10-12-8-6-5-7-9-12/h5-9,13-16,23H,10-11H2,1-4H3,(H2,21,22,28)/t13-,14+,15-,16+,20+/m1/s1 |
| InChIKey | CSRDKAQINPOMNX-YXTCSXCUSA-N |
| XLogP | 1.44 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|