C16H23NO4 — CID 101140014
(3aR,4S,5R,6R,6aS)-5-(benzylamino)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (PubChem CID 101140014) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (3aR,4S,5R,6R,6aS)-5-(benzylamino)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4S,5R,6R,6aS)-5-(benzylamino)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 101140014 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (3aR,4S,5R,6R,6aS)-5-(benzylamino)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O)[C@H](NCc3ccccc3)[C@H](CO)[C@@H]2O1 |
| InChI | InChI=1S/C16H23NO4/c1-16(2)20-14-11(9-18)12(13(19)15(14)21-16)17-8-10-6-4-3-5-7-10/h3-7,11-15,17-19H,8-9H2,1-2H3/t11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | XTPDWFVPBHIARC-AIEDFZFUSA-N |
| XLogP | 0.65 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |