C14H17NO4 — CID 139089978
(1R,4R,7S,8R,9S,10R)-6-benzyl-2,5-dioxa-6-azatricyclo[5.2.1.04,8]decane-9,10-diol (PubChem CID 139089978) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (1R,4R,7S,8R,9S,10R)-6-benzyl-2,5-dioxa-6-azatricyclo[5.2.1.04,8]decane-9,10-diol.
| Compound Name | (1R,4R,7S,8R,9S,10R)-6-benzyl-2,5-dioxa-6-azatricyclo[5.2.1.04,8]decane-9,10-diol |
|---|---|
| PubChem CID | 139089978 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (1R,4R,7S,8R,9S,10R)-6-benzyl-2,5-dioxa-6-azatricyclo[5.2.1.04,8]decane-9,10-diol |
| SMILES | O[C@@H]1[C@H]2OC[C@@H]3ON(Cc4ccccc4)[C@H]([C@H]2O)[C@H]13 |
| InChI | InChI=1S/C14H17NO4/c16-12-10-9-7-18-14(12)13(17)11(10)15(19-9)6-8-4-2-1-3-5-8/h1-5,9-14,16-17H,6-7H2/t9-,10+,11-,12-,13+,14+/m0/s1 |
| InChIKey | KYPYWZXQUXYMJC-XNBXPENISA-N |
| XLogP | -0.08 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |