C15H21NO4 — CID 10588744
(1R,3R,4R,5R,6S)-2-benzyl-3-[(1S)-1,2-dihydroxyethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol (PubChem CID 10588744) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (1R,3R,4R,5R,6S)-2-benzyl-3-[(1S)-1,2-dihydroxyethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol.
| Compound Name | (1R,3R,4R,5R,6S)-2-benzyl-3-[(1S)-1,2-dihydroxyethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol |
|---|---|
| PubChem CID | 10588744 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (1R,3R,4R,5R,6S)-2-benzyl-3-[(1S)-1,2-dihydroxyethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol |
| SMILES | OC[C@@H](O)[C@H]1[C@H]2C[C@H]([C@H](O)[C@@H]2O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO4/c17-8-12(18)13-10-6-11(15(20)14(10)19)16(13)7-9-4-2-1-3-5-9/h1-5,10-15,17-20H,6-8H2/t10-,11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | LTOGMYFIJJZTRX-OJVARPOJSA-N |
| XLogP | -0.67 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |