C14H16F3NO2 — CID 178143352
(3S)-2-benzyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]heptane-5,6-diol (PubChem CID 178143352) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (3S)-2-benzyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]heptane-5,6-diol.
| Compound Name | (3S)-2-benzyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]heptane-5,6-diol |
|---|---|
| PubChem CID | 178143352 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (3S)-2-benzyl-3-(trifluoromethyl)-2-azabicyclo[2.2.1]heptane-5,6-diol |
| SMILES | OC1C(O)C2CC1[C@@H](C(F)(F)F)N2Cc1ccccc1 |
| InChI | InChI=1S/C14H16F3NO2/c15-14(16,17)13-9-6-10(12(20)11(9)19)18(13)7-8-4-2-1-3-5-8/h1-5,9-13,19-20H,6-7H2/t9?,10?,11?,12?,13-/m0/s1 |
| InChIKey | XQUUCVFOHWEXIO-XHFUNPKLSA-N |
| XLogP | 1.54 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |