C18H25NO6 — CID 10498115
(1S,3S,4S,5S,6R)-2-benzyl-3-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-azabicyclo[2.2.1]heptane-5,6-diol (PubChem CID 10498115) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is (1S,3S,4S,5S,6R)-2-benzyl-3-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-azabicyclo[2.2.1]heptane-5,6-diol.
| Compound Name | (1S,3S,4S,5S,6R)-2-benzyl-3-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-azabicyclo[2.2.1]heptane-5,6-diol |
|---|---|
| PubChem CID | 10498115 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (1S,3S,4S,5S,6R)-2-benzyl-3-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-azabicyclo[2.2.1]heptane-5,6-diol |
| SMILES | OC[C@H]1O[C@@H]([C@@H]2[C@@H]3C[C@@H]([C@@H](O)[C@H]3O)N2Cc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H25NO6/c20-8-12-16(23)17(24)18(25-12)13-10-6-11(15(22)14(10)21)19(13)7-9-4-2-1-3-5-9/h1-5,10-18,20-24H,6-8H2/t10-,11-,12+,13-,14-,15+,16+,17-,18-/m0/s1 |
| InChIKey | HYYOUSUDSVXILO-ZMBWJSSISA-N |
| XLogP | -1.54 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |