C17H23NO4 — CID 11850529
(1'R,3aR,6R,7S,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol (PubChem CID 11850529) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (1'R,3aR,6R,7S,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol.
| Compound Name | (1'R,3aR,6R,7S,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol |
|---|---|
| PubChem CID | 11850529 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (1'R,3aR,6R,7S,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol |
| SMILES | O[C@@H]1CCC[C@@]12OC[C@@H]1CON(Cc3ccccc3)[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C17H23NO4/c19-14-7-4-8-17(14)16(20)15-13(10-21-17)11-22-18(15)9-12-5-2-1-3-6-12/h1-3,5-6,13-16,19-20H,4,7-11H2/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | FREFOZNYHXUWFK-UHDSXZAQSA-N |
| XLogP | 1.09 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |