C34H46N2O8 — CID 139089976
(1'S,3aR,6S,7R,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol (PubChem CID 139089976) has the molecular formula C34H46N2O8 and a molecular weight of 610.75 g/mol. Its IUPAC name is (1'S,3aR,6S,7R,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol.
| Compound Name | (1'S,3aR,6S,7R,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol |
|---|---|
| PubChem CID | 139089976 |
| Molecular Formula | C34H46N2O8 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | (1'S,3aR,6S,7R,7aS)-1-benzylspiro[3a,4,7,7a-tetrahydro-3H-pyrano[4,3-c][1,2]oxazole-6,2'-cyclopentane]-1',7-diol |
| SMILES | O[C@@H]1[C@@H]2[C@@H](CON2Cc2ccccc2)CO[C@]12CCC[C@@H]2O.O[C@@H]1[C@@H]2[C@@H](CON2Cc2ccccc2)CO[C@]12CCC[C@@H]2O |
| InChI | InChI=1S/2C17H23NO4/c2*19-14-7-4-8-17(14)16(20)15-13(10-21-17)11-22-18(15)9-12-5-2-1-3-6-12/h2*1-3,5-6,13-16,19-20H,4,7-11H2/t2*13-,14+,15+,16-,17+/m11/s1 |
| InChIKey | VLBNCSRJAKIVBK-WQLRWNOFSA-N |
| XLogP | 2.19 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |