C14H19NO2 — CID 141191797
2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol (PubChem CID 141191797) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol.
| Compound Name | 2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol |
|---|---|
| PubChem CID | 141191797 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-5,6-diol |
| SMILES | C[C@H](c1ccccc1)N1CC2CC1C(O)C2O |
| InChI | InChI=1S/C14H19NO2/c1-9(10-5-3-2-4-6-10)15-8-11-7-12(15)14(17)13(11)16/h2-6,9,11-14,16-17H,7-8H2,1H3/t9-,11?,12?,13?,14?/m1/s1 |
| InChIKey | XBYLHMYDZNIPHD-WSWXSABCSA-N |
| XLogP | 1.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |