C12H12O4S — CID 66726987
3-(benzylsulfanylmethyl)-1,4-dioxane-2,5-dione (PubChem CID 66726987) has the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-(benzylsulfanylmethyl)-1,4-dioxane-2,5-dione.
| Compound Name | 3-(benzylsulfanylmethyl)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 66726987 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 3-(benzylsulfanylmethyl)-1,4-dioxane-2,5-dione |
| SMILES | O=C1COC(=O)C(CSCc2ccccc2)O1 |
| InChI | InChI=1S/C12H12O4S/c13-11-6-15-12(14)10(16-11)8-17-7-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | UBWCSVHFFCEBOK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |