C7H10O5 — CID 123854269
3-(2-methoxyethyl)-1,4-dioxane-2,5-dione (PubChem CID 123854269) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1,4-dioxane-2,5-dione.
| Compound Name | 3-(2-methoxyethyl)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 123854269 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3-(2-methoxyethyl)-1,4-dioxane-2,5-dione |
| SMILES | COCCC1OC(=O)COC1=O |
| InChI | InChI=1S/C7H10O5/c1-10-3-2-5-7(9)11-4-6(8)12-5/h5H,2-4H2,1H3 |
| InChIKey | MLRHWUBCZPJGSB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |