C23H29NO3 — CID 118653490
(3S,7R,8R,9S)-3-amino-7-benzyl-9-methyl-8-(2-phenylethyl)-1,5-dioxonan-2-one (PubChem CID 118653490) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (3S,7R,8R,9S)-3-amino-7-benzyl-9-methyl-8-(2-phenylethyl)-1,5-dioxonan-2-one.
| Compound Name | (3S,7R,8R,9S)-3-amino-7-benzyl-9-methyl-8-(2-phenylethyl)-1,5-dioxonan-2-one |
|---|---|
| PubChem CID | 118653490 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (3S,7R,8R,9S)-3-amino-7-benzyl-9-methyl-8-(2-phenylethyl)-1,5-dioxonan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)COC[C@@H](Cc2ccccc2)[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-17-21(13-12-18-8-4-2-5-9-18)20(14-19-10-6-3-7-11-19)15-26-16-22(24)23(25)27-17/h2-11,17,20-22H,12-16,24H2,1H3/t17-,20+,21-,22-/m0/s1 |
| InChIKey | XARYUNKDLVHUTA-XGARDCMYSA-N |
| XLogP | 3.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |