C19H20O2 — CID 101239046
(3aR,4R,9aS)-9-benzyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-4-ol (PubChem CID 101239046) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (3aR,4R,9aS)-9-benzyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-4-ol.
| Compound Name | (3aR,4R,9aS)-9-benzyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-4-ol |
|---|---|
| PubChem CID | 101239046 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3aR,4R,9aS)-9-benzyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-4-ol |
| SMILES | O[C@H]1c2ccccc2C(Cc2ccccc2)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C19H20O2/c20-19-15-9-5-4-8-14(15)16(17-11-21-12-18(17)19)10-13-6-2-1-3-7-13/h1-9,16-20H,10-12H2/t16?,17-,18-,19-/m0/s1 |
| InChIKey | RWFIXIJZMYBDKY-JGINJTNGSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |