C19H21NO — CID 844320
(4aR,5R,9bS)-2-benzyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol (PubChem CID 844320) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (4aR,5R,9bS)-2-benzyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol.
| Compound Name | (4aR,5R,9bS)-2-benzyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol |
|---|---|
| PubChem CID | 844320 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (4aR,5R,9bS)-2-benzyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol |
| SMILES | O[C@H]1c2ccccc2[C@H]2CN(Cc3ccccc3)CC[C@H]21 |
| InChI | InChI=1S/C19H21NO/c21-19-16-9-5-4-8-15(16)18-13-20(11-10-17(18)19)12-14-6-2-1-3-7-14/h1-9,17-19,21H,10-13H2/t17-,18-,19+/m1/s1 |
| InChIKey | BLZVNGKZYVMGGU-QRVBRYPASA-N |
| XLogP | 3.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |