C16H19NO — CID 163859727
2-but-3-ynyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol (PubChem CID 163859727) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-but-3-ynyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol.
| Compound Name | 2-but-3-ynyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol |
|---|---|
| PubChem CID | 163859727 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-but-3-ynyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridin-5-ol |
| SMILES | C#CCCN1CCC2C(O)c3ccccc3C2C1 |
| InChI | InChI=1S/C16H19NO/c1-2-3-9-17-10-8-14-15(11-17)12-6-4-5-7-13(12)16(14)18/h1,4-7,14-16,18H,3,8-11H2 |
| InChIKey | PBKOGCPSRGPYCZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|